Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
| Linear Formula | HCl · CH3OH |
|---|---|
| CAS | 132228-87-6 |
| MDL Number | MFCD00011324 |
| Grade | For GC derivatization |
| Synonym | Hydrochloric acid in methanol |
| Formula Weight | 36.46 |
| Density | 0.831 g/mL (at 20°C) |
| Product Line | LiChropur |
1-Ethyl-3-methylimidazolium methyl sulfate, 98%
CAS: 516474-01-4 Molecular Formula: C7H14N2O4S Molecular Weight (g/mol): 222.259 MDL Number: MFCD08457697 InChI Key: BXSDLSWVIAITRQ-UHFFFAOYSA-M Synonym: 1-ethyl-3-methylimidazolium methyl sulfate,1-ethyl-3-methylimidazolium methylsulfate,1-ethyl-3-methyl-1h-imidazol-3-ium methyl sulfate,1-ethyl-3-methylimidazolium methyl sulfate 1-,1-ethyl-3-methylimidazoliummethylsulfate,dsstox_cid_29266,dsstox_rid_83385,dsstox_gsid_49310,1-ethyl-3-methylimidazolium methylsul-fate,1-ethyl-3-methylimidazolium methyl sulfate hplc PubChem CID: 16211409 IUPAC Name: 1-ethyl-3-methylimidazol-3-ium;methyl sulfate SMILES: CCN1C=C[N+](=C1)C.COS(=O)(=O)[O-]
| PubChem CID | 16211409 |
|---|---|
| CAS | 516474-01-4 |
| Molecular Weight (g/mol) | 222.259 |
| MDL Number | MFCD08457697 |
| SMILES | CCN1C=C[N+](=C1)C.COS(=O)(=O)[O-] |
| Synonym | 1-ethyl-3-methylimidazolium methyl sulfate,1-ethyl-3-methylimidazolium methylsulfate,1-ethyl-3-methyl-1h-imidazol-3-ium methyl sulfate,1-ethyl-3-methylimidazolium methyl sulfate 1-,1-ethyl-3-methylimidazoliummethylsulfate,dsstox_cid_29266,dsstox_rid_83385,dsstox_gsid_49310,1-ethyl-3-methylimidazolium methylsul-fate,1-ethyl-3-methylimidazolium methyl sulfate hplc |
| IUPAC Name | 1-ethyl-3-methylimidazol-3-ium;methyl sulfate |
| InChI Key | BXSDLSWVIAITRQ-UHFFFAOYSA-M |
| Molecular Formula | C7H14N2O4S |
5-Methyl-2-hexanone, 99%
CAS: 110-12-3 Molecular Formula: C7H14O Molecular Weight (g/mol): 114.19 MDL Number: MFCD00008950 InChI Key: FFWSICBKRCICMR-UHFFFAOYSA-N Synonym: 5-methyl-2-hexanone,2-hexanone, 5-methyl,isoamyl methyl ketone,methyl isoamyl ketone,miak,isopentyl methyl ketone,2-methyl-5-hexanone,ketone, methyl isoamyl,methyl isopentyl ketone,unii-6o4a4a5f28 PubChem CID: 8034 IUPAC Name: 5-methylhexan-2-one SMILES: CC(C)CCC(=O)C
| PubChem CID | 8034 |
|---|---|
| CAS | 110-12-3 |
| Molecular Weight (g/mol) | 114.19 |
| MDL Number | MFCD00008950 |
| SMILES | CC(C)CCC(=O)C |
| Synonym | 5-methyl-2-hexanone,2-hexanone, 5-methyl,isoamyl methyl ketone,methyl isoamyl ketone,miak,isopentyl methyl ketone,2-methyl-5-hexanone,ketone, methyl isoamyl,methyl isopentyl ketone,unii-6o4a4a5f28 |
| IUPAC Name | 5-methylhexan-2-one |
| InChI Key | FFWSICBKRCICMR-UHFFFAOYSA-N |
| Molecular Formula | C7H14O |
4-Phenyl-2-butanone, 98%
CAS: 2550-26-7 Molecular Formula: C10H12O Molecular Weight (g/mol): 148.205 MDL Number: MFCD00008790 InChI Key: AKGGYBADQZYZPD-UHFFFAOYSA-N Synonym: benzylacetone,4-phenyl-2-butanone,2-butanone, 4-phenyl,4-penylbutan-2-one,1-phenyl-3-butanone,methyl phenethyl ketone,benzyl acetone,methyl 2-phenylethyl ketone,phenethyl methyl ketone,methyl phenylethyl ketone PubChem CID: 17355 IUPAC Name: 4-phenylbutan-2-one SMILES: CC(=O)CCC1=CC=CC=C1
| PubChem CID | 17355 |
|---|---|
| CAS | 2550-26-7 |
| Molecular Weight (g/mol) | 148.205 |
| MDL Number | MFCD00008790 |
| SMILES | CC(=O)CCC1=CC=CC=C1 |
| Synonym | benzylacetone,4-phenyl-2-butanone,2-butanone, 4-phenyl,4-penylbutan-2-one,1-phenyl-3-butanone,methyl phenethyl ketone,benzyl acetone,methyl 2-phenylethyl ketone,phenethyl methyl ketone,methyl phenylethyl ketone |
| IUPAC Name | 4-phenylbutan-2-one |
| InChI Key | AKGGYBADQZYZPD-UHFFFAOYSA-N |
| Molecular Formula | C10H12O |
3-(1H-Imidazol-1-ylmethyl)aniline, 97%, Thermo Scientific™
CAS: 120107-85-9 Molecular Formula: C10H11N3 Molecular Weight (g/mol): 173.219 InChI Key: HOZXQBSHRUITCX-UHFFFAOYSA-N Synonym: 3-1h-imidazol-1-ylmethyl aniline,3-1h-imidazol-1-yl methyl aniline,3-imidazol-1-ylmethyl aniline,benzenamine, 3-1h-imidazol-1-ylmethyl,3-1-imidazolylmethyl aniline,3-imidazol-1-ylmethyl-phenylamine,benzenamine,3-1h-imidazol-1-ylmethyl,3-imidazolylmethyl phenylamine,acmc-20e0av PubChem CID: 6481821 IUPAC Name: 3-(imidazol-1-ylmethyl)aniline SMILES: C1=CC(=CC(=C1)N)CN2C=CN=C2
| PubChem CID | 6481821 |
|---|---|
| CAS | 120107-85-9 |
| Molecular Weight (g/mol) | 173.219 |
| SMILES | C1=CC(=CC(=C1)N)CN2C=CN=C2 |
| Synonym | 3-1h-imidazol-1-ylmethyl aniline,3-1h-imidazol-1-yl methyl aniline,3-imidazol-1-ylmethyl aniline,benzenamine, 3-1h-imidazol-1-ylmethyl,3-1-imidazolylmethyl aniline,3-imidazol-1-ylmethyl-phenylamine,benzenamine,3-1h-imidazol-1-ylmethyl,3-imidazolylmethyl phenylamine,acmc-20e0av |
| IUPAC Name | 3-(imidazol-1-ylmethyl)aniline |
| InChI Key | HOZXQBSHRUITCX-UHFFFAOYSA-N |
| Molecular Formula | C10H11N3 |
1-Ethyl-3-methylimidazolium thiocyanate, 98%, Thermo Scientific Chemicals
CAS: 331717-63-6 Molecular Formula: C7H11N3S Molecular Weight (g/mol): 169.246 MDL Number: MFCD06798182 InChI Key: VASPYXGQVWPGAB-UHFFFAOYSA-M Synonym: 1-ethyl-3-methylimidazolium thiocyanate,basionics™ vs 01,dsstox_cid_27860,dsstox_rid_82613,dsstox_gsid_47884,1-methyl-3-ethylimidazolium thiocyanate,1-ethyl-3-methyl imidazolium thio-cyanate,1-ethyl-3-methyl-1h-imidazol-3-ium thiocyanate,1-ethyl-3-methylimidazolium thiocyanate h-nmr, hplc,1-ethyl-3-methylimidazolium thiocyanate, for electrochemistry t PubChem CID: 16211115 IUPAC Name: 1-ethyl-3-methylimidazol-3-ium;thiocyanate SMILES: CCN1C=C[N+](=C1)C.C(#N)[S-]
| PubChem CID | 16211115 |
|---|---|
| CAS | 331717-63-6 |
| Molecular Weight (g/mol) | 169.246 |
| MDL Number | MFCD06798182 |
| SMILES | CCN1C=C[N+](=C1)C.C(#N)[S-] |
| Synonym | 1-ethyl-3-methylimidazolium thiocyanate,basionics™ vs 01,dsstox_cid_27860,dsstox_rid_82613,dsstox_gsid_47884,1-methyl-3-ethylimidazolium thiocyanate,1-ethyl-3-methyl imidazolium thio-cyanate,1-ethyl-3-methyl-1h-imidazol-3-ium thiocyanate,1-ethyl-3-methylimidazolium thiocyanate h-nmr, hplc,1-ethyl-3-methylimidazolium thiocyanate, for electrochemistry t |
| IUPAC Name | 1-ethyl-3-methylimidazol-3-ium;thiocyanate |
| InChI Key | VASPYXGQVWPGAB-UHFFFAOYSA-M |
| Molecular Formula | C7H11N3S |
1-Butyl-3-methylimidazolium chloride, 98+%
CAS: 79917-90-1 Molecular Formula: C8H15ClN2 Molecular Weight (g/mol): 174.67 MDL Number: MFCD03095425 InChI Key: FHDQNOXQSTVAIC-UHFFFAOYSA-M Synonym: 1-butyl-3-methylimidazolium chloride,3-butyl-1-methyl-1h-imidazol-3-ium chloride,1-n-butyl-3-methylimidazolium chloride,bmimcl,bmim cl,c4mim chloride,dsstox_cid_11461,dsstox_rid_78878,dsstox_gsid_31461 PubChem CID: 2734161 IUPAC Name: 1-butyl-3-methylimidazol-3-ium;chloride SMILES: [Cl-].CCCCN1C=C[N+](C)=C1
| PubChem CID | 2734161 |
|---|---|
| CAS | 79917-90-1 |
| Molecular Weight (g/mol) | 174.67 |
| MDL Number | MFCD03095425 |
| SMILES | [Cl-].CCCCN1C=C[N+](C)=C1 |
| Synonym | 1-butyl-3-methylimidazolium chloride,3-butyl-1-methyl-1h-imidazol-3-ium chloride,1-n-butyl-3-methylimidazolium chloride,bmimcl,bmim cl,c4mim chloride,dsstox_cid_11461,dsstox_rid_78878,dsstox_gsid_31461 |
| IUPAC Name | 1-butyl-3-methylimidazol-3-ium;chloride |
| InChI Key | FHDQNOXQSTVAIC-UHFFFAOYSA-M |
| Molecular Formula | C8H15ClN2 |
Methyl 4-(1H-imidazol-1-ylmethyl)benzoate, 97%, Thermo Scientific™
CAS: 160446-18-4 Molecular Formula: C12H12N2O2 Molecular Weight (g/mol): 216.24 MDL Number: MFCD00608318 InChI Key: HMWIIHIOSBESMH-UHFFFAOYSA-N Synonym: methyl 4-1h-imidazol-1-ylmethyl benzoate,methyl 4-imidazol-1-ylmethyl benzoate,methyl 4-1h-imidazol-1-yl methyl benzoate,methyl 4-imidazolylmethyl benzoate,4-imidazol-1-ylmethyl-benzoic acid methyl ester,4-1h-imidazol-1-ylmethyl benzoic acid methyl ester,benzoicacid, 4-1h-imidazol-1-ylmethyl-, methyl ester PubChem CID: 3164140 IUPAC Name: methyl 4-(imidazol-1-ylmethyl)benzoate SMILES: COC(=O)C1=CC=C(C=C1)CN2C=CN=C2
| PubChem CID | 3164140 |
|---|---|
| CAS | 160446-18-4 |
| Molecular Weight (g/mol) | 216.24 |
| MDL Number | MFCD00608318 |
| SMILES | COC(=O)C1=CC=C(C=C1)CN2C=CN=C2 |
| Synonym | methyl 4-1h-imidazol-1-ylmethyl benzoate,methyl 4-imidazol-1-ylmethyl benzoate,methyl 4-1h-imidazol-1-yl methyl benzoate,methyl 4-imidazolylmethyl benzoate,4-imidazol-1-ylmethyl-benzoic acid methyl ester,4-1h-imidazol-1-ylmethyl benzoic acid methyl ester,benzoicacid, 4-1h-imidazol-1-ylmethyl-, methyl ester |
| IUPAC Name | methyl 4-(imidazol-1-ylmethyl)benzoate |
| InChI Key | HMWIIHIOSBESMH-UHFFFAOYSA-N |
| Molecular Formula | C12H12N2O2 |
Uridine-5'-diphosphate disodium salt, 98%
CAS: 27821-45-0 Molecular Formula: C9H12N2Na2O12P2 Molecular Weight (g/mol): 448.12 MDL Number: MFCD00006524,MFCD00084679,MFCD04975448 InChI Key: ZQKVPFKBNNAXCE-HVQNCJTOSA-L Synonym: 5'-udp,2na PubChem CID: 131676107 SMILES: [Na+].[Na+].OC1C(O)[C@@H](O[C@@H]1COP(O)(=O)OP([O-])([O-])=O)N1C=CC(=O)NC1=O
| PubChem CID | 131676107 |
|---|---|
| CAS | 27821-45-0 |
| Molecular Weight (g/mol) | 448.12 |
| MDL Number | MFCD00006524,MFCD00084679,MFCD04975448 |
| SMILES | [Na+].[Na+].OC1C(O)[C@@H](O[C@@H]1COP(O)(=O)OP([O-])([O-])=O)N1C=CC(=O)NC1=O |
| Synonym | 5'-udp,2na |
| InChI Key | ZQKVPFKBNNAXCE-HVQNCJTOSA-L |
| Molecular Formula | C9H12N2Na2O12P2 |
3-Methyl-2-pentanone, 98+%
CAS: 565-61-7 Molecular Formula: C6H12O Molecular Weight (g/mol): 100.161 MDL Number: MFCD00009336 InChI Key: UIHCLUNTQKBZGK-UHFFFAOYSA-N Synonym: 3-methyl-2-pentanone,2-pentanone, 3-methyl,methyl sec-butyl ketone,sec-butyl methyl ketone,methyl 1-methylpropyl ketone,+/--3-methyl-pentan-2-one,methylethylacetone,sec-c4h9coch3,3-methyl-pentan-2-one,acmc-1alw4 PubChem CID: 11262 IUPAC Name: 3-methylpentan-2-one SMILES: CCC(C)C(=O)C
| PubChem CID | 11262 |
|---|---|
| CAS | 565-61-7 |
| Molecular Weight (g/mol) | 100.161 |
| MDL Number | MFCD00009336 |
| SMILES | CCC(C)C(=O)C |
| Synonym | 3-methyl-2-pentanone,2-pentanone, 3-methyl,methyl sec-butyl ketone,sec-butyl methyl ketone,methyl 1-methylpropyl ketone,+/--3-methyl-pentan-2-one,methylethylacetone,sec-c4h9coch3,3-methyl-pentan-2-one,acmc-1alw4 |
| IUPAC Name | 3-methylpentan-2-one |
| InChI Key | UIHCLUNTQKBZGK-UHFFFAOYSA-N |
| Molecular Formula | C6H12O |
TraceCERT™ EPA 524 Internal Standard Mix, Certified Reference Material, MilliporeSigma™ Supelco™
This certified reference material (CRM) is produced and certified in accordance with ISO/IEC 17025 and ISO 17034. This CRM is traceable to the SI through a primary reference material from a NMI. Certified content incl. uncertainty and expiry date are stated on the enclosed certificate.
Perfluoropentanoic Acid Analytical Standard, MilliporeSigma™ Supelco™
Perfluoropentanoic Acid is a persistent organic pollutant belonging to the perfluorinated (PFCs) class of compounds. These compounds are used in a variety of industrial applications such as textile paints, polishes, adhesives, electronics, waxes, stain repellents, and food packaging.
2,2,6,6-Tetramethyl-3,5-heptanedione, 98%
CAS: 1118-71-4 Molecular Formula: C11H20O2 Molecular Weight (g/mol): 184.279 MDL Number: MFCD00008848 InChI Key: YRAJNWYBUCUFBD-UHFFFAOYSA-N Synonym: dipivaloylmethane,2,2,6,6-tetramethyl-3,5-heptanedione,3,5-heptanedione, 2,2,6,6-tetramethyl,unii-r8ui909hoy,tmhd,2,2,6,6-tetramethyl-3,5-heptanedione dipivaloylmethane,r8ui909hoy,2,2,6,6-tetramethyl-heptane-3,5-dione,pubchem12497 PubChem CID: 70700 IUPAC Name: 2,2,6,6-tetramethylheptane-3,5-dione SMILES: CC(C)(C)C(=O)CC(=O)C(C)(C)C
| PubChem CID | 70700 |
|---|---|
| CAS | 1118-71-4 |
| Molecular Weight (g/mol) | 184.279 |
| MDL Number | MFCD00008848 |
| SMILES | CC(C)(C)C(=O)CC(=O)C(C)(C)C |
| Synonym | dipivaloylmethane,2,2,6,6-tetramethyl-3,5-heptanedione,3,5-heptanedione, 2,2,6,6-tetramethyl,unii-r8ui909hoy,tmhd,2,2,6,6-tetramethyl-3,5-heptanedione dipivaloylmethane,r8ui909hoy,2,2,6,6-tetramethyl-heptane-3,5-dione,pubchem12497 |
| IUPAC Name | 2,2,6,6-tetramethylheptane-3,5-dione |
| InChI Key | YRAJNWYBUCUFBD-UHFFFAOYSA-N |
| Molecular Formula | C11H20O2 |
1-Acetylcyclohexene, 97%
CAS: 932-66-1 Molecular Formula: C8H12O Molecular Weight (g/mol): 124.18 MDL Number: MFCD00001547 InChI Key: LTYLUDGDHUEBGX-UHFFFAOYSA-N Synonym: 1-acetyl-1-cyclohexene,1-acetylcyclohexene,1-cyclohex-1-en-1-yl ethanone,1-cyclohexen-1-yl ethanone,ethanone, 1-1-cyclohexen-1-yl,ketone, 1-cyclohexen-1-yl methyl,unii-7539u6wqbl,methyl 1-cyclohexenyl ketone,1-cyclohexen-1-yl methyl ketone,1-1-cyclohexenyl-ethanone PubChem CID: 13612 IUPAC Name: 1-(cyclohexen-1-yl)ethanone SMILES: CC(=O)C1=CCCCC1
| PubChem CID | 13612 |
|---|---|
| CAS | 932-66-1 |
| Molecular Weight (g/mol) | 124.18 |
| MDL Number | MFCD00001547 |
| SMILES | CC(=O)C1=CCCCC1 |
| Synonym | 1-acetyl-1-cyclohexene,1-acetylcyclohexene,1-cyclohex-1-en-1-yl ethanone,1-cyclohexen-1-yl ethanone,ethanone, 1-1-cyclohexen-1-yl,ketone, 1-cyclohexen-1-yl methyl,unii-7539u6wqbl,methyl 1-cyclohexenyl ketone,1-cyclohexen-1-yl methyl ketone,1-1-cyclohexenyl-ethanone |
| IUPAC Name | 1-(cyclohexen-1-yl)ethanone |
| InChI Key | LTYLUDGDHUEBGX-UHFFFAOYSA-N |
| Molecular Formula | C8H12O |
(S)-(+)-S-Methyl-S-phenylsulfoximine, 97%
CAS: 33903-50-3 Molecular Formula: C7H9NOS Molecular Weight (g/mol): 155.215 MDL Number: MFCD00151461 InChI Key: YFYIDTVGWCYSEO-JTQLQIEISA-N Synonym: s-+-s-methyl-s-phenylsulfoximine,s-+-s-methyl-s-phenylsulfoximine ee,s-imino methyl phenyl-??-sulfanone,r---s-methyl-s-phenylsulfoximine ee,imino-methyl-oxo-phenyl-$l^ 6,s-+-s-methyl-s-phenylsulphoximine,sulfoximine,s-methyl-s-phenyl-, s s PubChem CID: 25036288 IUPAC Name: imino-methyl-oxo-phenyl-$l^{6}-sulfane SMILES: CS(=N)(=O)C1=CC=CC=C1
| PubChem CID | 25036288 |
|---|---|
| CAS | 33903-50-3 |
| Molecular Weight (g/mol) | 155.215 |
| MDL Number | MFCD00151461 |
| SMILES | CS(=N)(=O)C1=CC=CC=C1 |
| Synonym | s-+-s-methyl-s-phenylsulfoximine,s-+-s-methyl-s-phenylsulfoximine ee,s-imino methyl phenyl-??-sulfanone,r---s-methyl-s-phenylsulfoximine ee,imino-methyl-oxo-phenyl-$l^ 6,s-+-s-methyl-s-phenylsulphoximine,sulfoximine,s-methyl-s-phenyl-, s s |
| IUPAC Name | imino-methyl-oxo-phenyl-$l^{6}-sulfane |
| InChI Key | YFYIDTVGWCYSEO-JTQLQIEISA-N |
| Molecular Formula | C7H9NOS |